C18H23ClN4 — CID 44723897
(E)-N-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-1-pyridin-2-ylmethanimine;hydrochloride (PubChem CID 44723897) has the molecular formula C18H23ClN4 and a molecular weight of 330.86 g/mol. Its IUPAC name is (E)-N-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-1-pyridin-2-ylmethanimine;hydrochloride.
| Compound Name | (E)-N-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-1-pyridin-2-ylmethanimine;hydrochloride |
|---|---|
| PubChem CID | 44723897 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (E)-N-[4-[(4-methylphenyl)methyl]piperazin-1-yl]-1-pyridin-2-ylmethanimine;hydrochloride |
| SMILES | Cc1ccc(CN2CCN(/N=C/c3ccccn3)CC2)cc1.Cl |
| InChI | InChI=1S/C18H22N4.ClH/c1-16-5-7-17(8-6-16)15-21-10-12-22(13-11-21)20-14-18-4-2-3-9-19-18;/h2-9,14H,10-13,15H2,1H3;1H/b20-14+; |
| InChIKey | UDAOUYPPYPBTHO-RANVTSCRSA-N |
| XLogP | 2.96 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|