C20H23N3O4 — CID 44724470
benzyl N-[2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]-N-methylcarbamate (PubChem CID 44724470) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is benzyl N-[2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | benzyl N-[2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 44724470 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | benzyl N-[2-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]-N-methylcarbamate |
| SMILES | CN(CC(=O)N[C@@H](Cc1ccccc1)C(N)=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H23N3O4/c1-23(20(26)27-14-16-10-6-3-7-11-16)13-18(24)22-17(19(21)25)12-15-8-4-2-5-9-15/h2-11,17H,12-14H2,1H3,(H2,21,25)(H,22,24)/t17-/m0/s1 |
| InChIKey | XDMXOAJLNYIXGF-KRWDZBQOSA-N |
| XLogP | 1.47 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |