C19H24N2OS — CID 44725140
(1S,4R)-N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 44725140) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is (1S,4R)-N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,4R)-N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 44725140 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1S,4R)-N-(3-cyano-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | N#Cc1c(NC(=O)C2C[C@@H]3CC[C@H]2C3)sc2c1CCCCCC2 |
| InChI | InChI=1S/C19H24N2OS/c20-11-16-14-5-3-1-2-4-6-17(14)23-19(16)21-18(22)15-10-12-7-8-13(15)9-12/h12-13,15H,1-10H2,(H,21,22)/t12-,13+,15?/m1/s1 |
| InChIKey | HZTVMUPFFFOFAU-NEJHNUGDSA-N |
| XLogP | 4.65 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |