C4H5F2N5 — CID 44725305
6-(difluoromethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 44725305) has the molecular formula C4H5F2N5 and a molecular weight of 161.12 g/mol. Its IUPAC name is 6-(difluoromethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(difluoromethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 44725305 |
| Molecular Formula | C4H5F2N5 |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 6-(difluoromethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C(F)F)n1 |
| InChI | InChI=1S/C4H5F2N5/c5-1(6)2-9-3(7)11-4(8)10-2/h1H,(H4,7,8,9,10,11) |
| InChIKey | UICKOYROZKYGSJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |