About 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine
2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine (PubChem CID 44725605) has the molecular formula C21H13N5
and a molecular weight of 335.37 g/mol. Its IUPAC name is 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine |
| PubChem CID | 44725605 |
| Molecular Formula | C21H13N5 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine |
| SMILES | c1cc(-c2ccc3cccnc3n2)nc(-c2ccc3cccnc3n2)c1 |
| InChI | InChI=1S/C21H13N5/c1-6-16(18-10-8-14-4-2-12-22-20(14)25-18)24-17(7-1)19-11-9-15-5-3-13-23-21(15)26-19/h1-13H |
| InChIKey | GCWQHGOOKSHNBK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine?
The IUPAC name of 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine (CID 44725605) is 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine.
What is the SMILES notation for 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine?
The canonical SMILES for 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine is c1cc(-c2ccc3cccnc3n2)nc(-c2ccc3cccnc3n2)c1.
What is the InChIKey of 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine?
The InChIKey is GCWQHGOOKSHNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13N5/c1-6-16(18-10-8-14-4-2-12-22-20(14)25-18)24-17(7-1)19-11-9-15-5-3-13-23-21(15)26-19/h1-13H.
What are the key properties of 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine?
2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine has a molecular weight of 335.37 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(1,8-naphthyridin-2-yl)-2-pyridinyl]-1,8-naphthyridine is sourced from PubChem (CID 44725605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).