About 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride
2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride (PubChem CID 44725654) has the molecular formula C21H25ClN2O2
and a molecular weight of 372.90 g/mol. Its IUPAC name is 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride.
Molecular Properties
| Compound Name | 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride |
| PubChem CID | 44725654 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride |
| SMILES | O=C(CN1CCC[NH+](CC(=O)c2ccccc2)CC1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H24N2O2.ClH/c24-20(18-8-3-1-4-9-18)16-22-12-7-13-23(15-14-22)17-21(25)19-10-5-2-6-11-19;/h1-6,8-11H,7,12-17H2;1H |
| InChIKey | FKXHBMOGJSGINX-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride?
The IUPAC name of 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride (CID 44725654) is 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride.
What is the SMILES notation for 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride?
The canonical SMILES for 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride is O=C(CN1CCC[NH+](CC(=O)c2ccccc2)CC1)c1ccccc1.[Cl-].
What is the InChIKey of 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride?
The InChIKey is FKXHBMOGJSGINX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O2.ClH/c24-20(18-8-3-1-4-9-18)16-22-12-7-13-23(15-14-22)17-21(25)19-10-5-2-6-11-19;/h1-6,8-11H,7,12-17H2;1H.
What are the key properties of 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride?
2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride has a molecular weight of 372.90 g/mol, XLogP of -1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenacyl-1,4-diazepan-1-ium-1-yl)-1-phenylethanone chloride is sourced from PubChem (CID 44725654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).