About 2-aminoethylazanium;4-methylbenzenesulfonate
2-aminoethylazanium;4-methylbenzenesulfonate (PubChem CID 44726021) has the molecular formula C9H16N2O3S
and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-aminoethylazanium;4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-aminoethylazanium;4-methylbenzenesulfonate |
| PubChem CID | 44726021 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-aminoethylazanium;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.NCC[NH3+] |
| InChI | InChI=1S/C7H8O3S.C2H8N2/c1-6-2-4-7(5-3-6)11(8,9)10;3-1-2-4/h2-5H,1H3,(H,8,9,10);1-4H2 |
| InChIKey | HVCCFMAPGCBCHZ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethylazanium;4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethylazanium;4-methylbenzenesulfonate?
The IUPAC name of 2-aminoethylazanium;4-methylbenzenesulfonate (CID 44726021) is 2-aminoethylazanium;4-methylbenzenesulfonate.
What is the SMILES notation for 2-aminoethylazanium;4-methylbenzenesulfonate?
The canonical SMILES for 2-aminoethylazanium;4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)[O-])cc1.NCC[NH3+].
What is the InChIKey of 2-aminoethylazanium;4-methylbenzenesulfonate?
The InChIKey is HVCCFMAPGCBCHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C2H8N2/c1-6-2-4-7(5-3-6)11(8,9)10;3-1-2-4/h2-5H,1H3,(H,8,9,10);1-4H2.
What are the key properties of 2-aminoethylazanium;4-methylbenzenesulfonate?
2-aminoethylazanium;4-methylbenzenesulfonate has a molecular weight of 232.31 g/mol, XLogP of -0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethylazanium;4-methylbenzenesulfonate is sourced from PubChem (CID 44726021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).