C14H15N5O — CID 44726870
5,8-diethyl-12-methyl-13-oxa-3,4,6,7,9-pentazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(15),2,4,7,10(14),11-hexaene (PubChem CID 44726870) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 5,8-diethyl-12-methyl-13-oxa-3,4,6,7,9-pentazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(15),2,4,7,10(14),11-hexaene.
| Compound Name | 5,8-diethyl-12-methyl-13-oxa-3,4,6,7,9-pentazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(15),2,4,7,10(14),11-hexaene |
|---|---|
| PubChem CID | 44726870 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 5,8-diethyl-12-methyl-13-oxa-3,4,6,7,9-pentazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(15),2,4,7,10(14),11-hexaene |
| SMILES | CCc1nnc2c3cc4oc(C)cc4n3c(CC)nn12 |
| InChI | InChI=1S/C14H15N5O/c1-4-12-15-16-14-10-7-11-9(6-8(3)20-11)18(10)13(5-2)17-19(12)14/h6-7H,4-5H2,1-3H3 |
| InChIKey | XKWMSWNCBSPHIJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |