C20H15N7O2S2 — CID 44753346
2-[(8-methoxy-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 44753346) has the molecular formula C20H15N7O2S2 and a molecular weight of 449.52 g/mol. Its IUPAC name is 2-[(8-methoxy-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(8-methoxy-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 44753346 |
| Molecular Formula | C20H15N7O2S2 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[(8-methoxy-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | COc1ccc2[nH]c3nc(SCC(=O)Nc4nnc(-c5ccccc5)s4)nnc3c2c1 |
| InChI | InChI=1S/C20H15N7O2S2/c1-29-12-7-8-14-13(9-12)16-17(21-14)23-19(26-24-16)30-10-15(28)22-20-27-25-18(31-20)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,21,23,26)(H,22,27,28) |
| InChIKey | KADUIZWRHKUIOX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |