C14H16N4O3S2 — CID 44754631
1-(3-acetylphenyl)-3-[3-(2-methoxyethylsulfanyl)-1,2,4-thiadiazol-5-yl]urea (PubChem CID 44754631) has the molecular formula C14H16N4O3S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[3-(2-methoxyethylsulfanyl)-1,2,4-thiadiazol-5-yl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[3-(2-methoxyethylsulfanyl)-1,2,4-thiadiazol-5-yl]urea |
|---|---|
| PubChem CID | 44754631 |
| Molecular Formula | C14H16N4O3S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[3-(2-methoxyethylsulfanyl)-1,2,4-thiadiazol-5-yl]urea |
| SMILES | COCCSc1nsc(NC(=O)Nc2cccc(C(C)=O)c2)n1 |
| InChI | InChI=1S/C14H16N4O3S2/c1-9(19)10-4-3-5-11(8-10)15-12(20)16-13-17-14(18-23-13)22-7-6-21-2/h3-5,8H,6-7H2,1-2H3,(H2,15,16,17,18,20) |
| InChIKey | ZQRIELCJUYFBKT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|