About (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid
(6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid (PubChem CID 44755186) has the molecular formula C7H9BBrNO2
and a molecular weight of 229.87 g/mol. Its IUPAC name is (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid.
Molecular Properties
| Compound Name | (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid |
| PubChem CID | 44755186 |
| Molecular Formula | C7H9BBrNO2 |
| Molecular Weight | 229.87 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid |
| SMILES | Cc1cc(Br)nc(C)c1B(O)O |
| InChI | InChI=1S/C7H9BBrNO2/c1-4-3-6(9)10-5(2)7(4)8(11)12/h3,11-12H,1-2H3 |
| InChIKey | GXXITYQLWOMIEM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.87 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid?
The IUPAC name of (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid (CID 44755186) is (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid.
What is the SMILES notation for (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid?
The canonical SMILES for (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid is Cc1cc(Br)nc(C)c1B(O)O.
What is the InChIKey of (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid?
The InChIKey is GXXITYQLWOMIEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BBrNO2/c1-4-3-6(9)10-5(2)7(4)8(11)12/h3,11-12H,1-2H3.
What are the key properties of (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid?
(6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid has a molecular weight of 229.87 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,4-dimethyl-3-pyridinyl)boronic acid is sourced from PubChem (CID 44755186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).