C28H22F3N3O4S — CID 44755657
(E)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-[1-[3-(trifluoromethyl)phenyl]sulfonylindol-3-yl]prop-2-enamide (PubChem CID 44755657) has the molecular formula C28H22F3N3O4S and a molecular weight of 553.56 g/mol. Its IUPAC name is (E)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-[1-[3-(trifluoromethyl)phenyl]sulfonylindol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-[1-[3-(trifluoromethyl)phenyl]sulfonylindol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 44755657 |
| Molecular Formula | C28H22F3N3O4S |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | (E)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-[1-[3-(trifluoromethyl)phenyl]sulfonylindol-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(S(=O)(=O)c2cccc(C(F)(F)F)c2)c2ccccc12)NCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C28H22F3N3O4S/c29-28(30,31)20-4-3-5-22(14-20)39(37,38)34-17-19(23-6-1-2-7-26(23)34)8-11-27(36)32-13-12-18-16-33-25-10-9-21(35)15-24(18)25/h1-11,14-17,33,35H,12-13H2,(H,32,36)/b11-8+ |
| InChIKey | YEQVCORZDVSOEM-DHZHZOJOSA-N |
| XLogP | 5.46 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|