C18H27NO4S — CID 44755784
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 44755784) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 44755784 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC/C=C(\C)CCC=C(C)C)cc1OC |
| InChI | InChI=1S/C18H27NO4S/c1-14(2)7-6-8-15(3)11-12-19-24(20,21)16-9-10-17(22-4)18(13-16)23-5/h7,9-11,13,19H,6,8,12H2,1-5H3/b15-11+ |
| InChIKey | XXQDFGQEGXAATR-RVDMUPIBSA-N |
| XLogP | 3.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|