About (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide
(2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide (PubChem CID 44756509) has the molecular formula C17H28N2O2
and a molecular weight of 292.42 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide.
Molecular Properties
| Compound Name | (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide |
| PubChem CID | 44756509 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)NCCCN1CCCC1=O |
| InChI | InChI=1S/C17H28N2O2/c1-14(2)7-4-8-15(3)13-16(20)18-10-6-12-19-11-5-9-17(19)21/h7,13H,4-6,8-12H2,1-3H3,(H,18,20)/b15-13+ |
| InChIKey | ZCJUTEWJGWOIAT-FYWRMAATSA-N |
| XLogP | 2.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide?
The IUPAC name of (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide (CID 44756509) is (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide.
What is the SMILES notation for (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide?
The canonical SMILES for (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide is CC(C)=CCC/C(C)=C/C(=O)NCCCN1CCCC1=O.
What is the InChIKey of (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide?
The InChIKey is ZCJUTEWJGWOIAT-FYWRMAATSA-N. The full InChI is InChI=1S/C17H28N2O2/c1-14(2)7-4-8-15(3)13-16(20)18-10-6-12-19-11-5-9-17(19)21/h7,13H,4-6,8-12H2,1-3H3,(H,18,20)/b15-13+.
What are the key properties of (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide?
(2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide has a molecular weight of 292.42 g/mol, XLogP of 2.81, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,7-dimethyl-N-[3-(2-oxopyrrolidin-1-yl)propyl]octa-2,6-dienamide is sourced from PubChem (CID 44756509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).