C14H23NO3 — CID 44757268
4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-4-oxobutanoic acid (PubChem CID 44757268) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 44757268 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H23NO3/c1-11(2)5-4-6-12(3)9-10-15-13(16)7-8-14(17)18/h5,9H,4,6-8,10H2,1-3H3,(H,15,16)(H,17,18)/b12-9+ |
| InChIKey | TVLKOLFDGQNOFX-FMIVXFBMSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|