C14H21FN2O2S — CID 44757376
3-[(4-fluorophenyl)methyl]-1,1-bis(2-methoxyethyl)thiourea (PubChem CID 44757376) has the molecular formula C14H21FN2O2S and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-1,1-bis(2-methoxyethyl)thiourea.
| Compound Name | 3-[(4-fluorophenyl)methyl]-1,1-bis(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 44757376 |
| Molecular Formula | C14H21FN2O2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-1,1-bis(2-methoxyethyl)thiourea |
| SMILES | COCCN(CCOC)C(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FN2O2S/c1-18-9-7-17(8-10-19-2)14(20)16-11-12-3-5-13(15)6-4-12/h3-6H,7-11H2,1-2H3,(H,16,20) |
| InChIKey | KXAVHRAGXYGMLV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|