C29H33N3O2 — CID 44757691
(3R,4R)-N-[3-(N-methylanilino)propyl]-1-oxo-3-phenyl-2-propan-2-yl-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 44757691) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is (3R,4R)-N-[3-(N-methylanilino)propyl]-1-oxo-3-phenyl-2-propan-2-yl-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-N-[3-(N-methylanilino)propyl]-1-oxo-3-phenyl-2-propan-2-yl-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 44757691 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | (3R,4R)-N-[3-(N-methylanilino)propyl]-1-oxo-3-phenyl-2-propan-2-yl-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CC(C)N1C(=O)c2ccccc2[C@@H](C(=O)NCCCN(C)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C29H33N3O2/c1-21(2)32-27(22-13-6-4-7-14-22)26(24-17-10-11-18-25(24)29(32)34)28(33)30-19-12-20-31(3)23-15-8-5-9-16-23/h4-11,13-18,21,26-27H,12,19-20H2,1-3H3,(H,30,33)/t26-,27+/m1/s1 |
| InChIKey | MRIDMYHRWCMLBF-SXOMAYOGSA-N |
| XLogP | 5.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|