C26H30N2O2 — CID 44760533
6-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(4-propan-2-ylphenyl)cyclohex-3-ene-1-carboxamide (PubChem CID 44760533) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(4-propan-2-ylphenyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(4-propan-2-ylphenyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 44760533 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 6-(3,4-dihydro-1H-isoquinoline-2-carbonyl)-N-(4-propan-2-ylphenyl)cyclohex-3-ene-1-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)C2CC=CCC2C(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-18(2)19-11-13-22(14-12-19)27-25(29)23-9-5-6-10-24(23)26(30)28-16-15-20-7-3-4-8-21(20)17-28/h3-8,11-14,18,23-24H,9-10,15-17H2,1-2H3,(H,27,29) |
| InChIKey | QUUJYVOTBZPOMJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|