C24H25F3N4O2 — CID 44761699
6-(4-pyridin-2-ylpiperazine-1-carbonyl)-N-[3-(trifluoromethyl)phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 44761699) has the molecular formula C24H25F3N4O2 and a molecular weight of 458.48 g/mol. Its IUPAC name is 6-(4-pyridin-2-ylpiperazine-1-carbonyl)-N-[3-(trifluoromethyl)phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | 6-(4-pyridin-2-ylpiperazine-1-carbonyl)-N-[3-(trifluoromethyl)phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 44761699 |
| Molecular Formula | C24H25F3N4O2 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 6-(4-pyridin-2-ylpiperazine-1-carbonyl)-N-[3-(trifluoromethyl)phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1CC=CCC1C(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C24H25F3N4O2/c25-24(26,27)17-6-5-7-18(16-17)29-22(32)19-8-1-2-9-20(19)23(33)31-14-12-30(13-15-31)21-10-3-4-11-28-21/h1-7,10-11,16,19-20H,8-9,12-15H2,(H,29,32) |
| InChIKey | ICOKZZSZYAYICK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|