C22H24N4O2 — CID 44763707
4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 44763707) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 44763707 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 4-[5-amino-3-(3-methylphenyl)pyrazol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | Cc1cccc(-c2cc(N)n(-c3ccc(C(=O)NC[C@@H]4CCCO4)cc3)n2)c1 |
| InChI | InChI=1S/C22H24N4O2/c1-15-4-2-5-17(12-15)20-13-21(23)26(25-20)18-9-7-16(8-10-18)22(27)24-14-19-6-3-11-28-19/h2,4-5,7-10,12-13,19H,3,6,11,14,23H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | SFZHGRVZDXRBOP-IBGZPJMESA-N |
| XLogP | 3.34 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |