C27H36N2O6S — CID 44764935
tert-butyl N-[6-[[2,3-dihydro-1-benzofuran-5-yl-(4-methylsulfonylphenyl)methyl]amino]-6-oxohexyl]carbamate (PubChem CID 44764935) has the molecular formula C27H36N2O6S and a molecular weight of 516.66 g/mol. Its IUPAC name is tert-butyl N-[6-[[2,3-dihydro-1-benzofuran-5-yl-(4-methylsulfonylphenyl)methyl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[2,3-dihydro-1-benzofuran-5-yl-(4-methylsulfonylphenyl)methyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 44764935 |
| Molecular Formula | C27H36N2O6S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | tert-butyl N-[6-[[2,3-dihydro-1-benzofuran-5-yl-(4-methylsulfonylphenyl)methyl]amino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)NC(c1ccc(S(C)(=O)=O)cc1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C27H36N2O6S/c1-27(2,3)35-26(31)28-16-7-5-6-8-24(30)29-25(19-9-12-22(13-10-19)36(4,32)33)21-11-14-23-20(18-21)15-17-34-23/h9-14,18,25H,5-8,15-17H2,1-4H3,(H,28,31)(H,29,30) |
| InChIKey | CDMYTYJJFJVJGE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|