C21H23F3N4O2 — CID 44765662
N-[(1S)-2-methyl-1-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propyl]-4-phenoxybutanamide (PubChem CID 44765662) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propyl]-4-phenoxybutanamide.
| Compound Name | N-[(1S)-2-methyl-1-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 44765662 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[(1S)-2-methyl-1-[8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propyl]-4-phenoxybutanamide |
| SMILES | CC(C)[C@H](NC(=O)CCCOc1ccccc1)c1nnc2c(C(F)(F)F)cccn12 |
| InChI | InChI=1S/C21H23F3N4O2/c1-14(2)18(25-17(29)11-7-13-30-15-8-4-3-5-9-15)20-27-26-19-16(21(22,23)24)10-6-12-28(19)20/h3-6,8-10,12,14,18H,7,11,13H2,1-2H3,(H,25,29)/t18-/m0/s1 |
| InChIKey | PMFFTNOQCHJMBT-SFHVURJKSA-N |
| XLogP | 4.42 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|