C19H17ClF4N2O — CID 44765736
N-[4-chloro-3-(trifluoromethyl)phenyl]-4-(4-fluorophenyl)piperidine-1-carboxamide (PubChem CID 44765736) has the molecular formula C19H17ClF4N2O and a molecular weight of 400.80 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-4-(4-fluorophenyl)piperidine-1-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-(4-fluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 44765736 |
| Molecular Formula | C19H17ClF4N2O |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-(4-fluorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)N1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H17ClF4N2O/c20-17-6-5-15(11-16(17)19(22,23)24)25-18(27)26-9-7-13(8-10-26)12-1-3-14(21)4-2-12/h1-6,11,13H,7-10H2,(H,25,27) |
| InChIKey | MZGUADBQNZHILS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |