C18H18ClN3O5 — CID 44770169
5-[2-(6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 44770169) has the molecular formula C18H18ClN3O5 and a molecular weight of 391.81 g/mol. Its IUPAC name is 5-[2-(6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-(6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 44770169 |
| Molecular Formula | C18H18ClN3O5 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 5-[2-(6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CC(=O)N2CCC3(CC2)CC(=O)c2cc(Cl)ccc2O3)N1 |
| InChI | InChI=1S/C18H18ClN3O5/c19-10-1-2-14-11(7-10)13(23)9-18(27-14)3-5-22(6-4-18)15(24)8-12-16(25)21-17(26)20-12/h1-2,7,12H,3-6,8-9H2,(H2,20,21,25,26) |
| InChIKey | CWVSTPCYNCGCOJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|