C19H20F3N5O2 — CID 44778030
N-[(1S,2R)-2-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]benzamide (PubChem CID 44778030) has the molecular formula C19H20F3N5O2 and a molecular weight of 407.40 g/mol. Its IUPAC name is N-[(1S,2R)-2-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]benzamide.
| Compound Name | N-[(1S,2R)-2-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 44778030 |
| Molecular Formula | C19H20F3N5O2 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[(1S,2R)-2-[[[4-(trifluoromethyl)pyrimidin-2-yl]amino]carbamoyl]cyclohexyl]benzamide |
| SMILES | O=C(N[C@H]1CCCC[C@H]1C(=O)NNc1nccc(C(F)(F)F)n1)c1ccccc1 |
| InChI | InChI=1S/C19H20F3N5O2/c20-19(21,22)15-10-11-23-18(25-15)27-26-17(29)13-8-4-5-9-14(13)24-16(28)12-6-2-1-3-7-12/h1-3,6-7,10-11,13-14H,4-5,8-9H2,(H,24,28)(H,26,29)(H,23,25,27)/t13-,14+/m1/s1 |
| InChIKey | PSJAIGMATGIBNA-KGLIPLIRSA-N |
| XLogP | 2.93 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|