About 2,3,5-triphenyl-1H-tetrazole;hydrochloride
2,3,5-triphenyl-1H-tetrazole;hydrochloride (PubChem CID 44782304) has the molecular formula C19H17ClN4
and a molecular weight of 336.83 g/mol. Its IUPAC name is 2,3,5-triphenyl-1H-tetrazole;hydrochloride.
Molecular Properties
| Compound Name | 2,3,5-triphenyl-1H-tetrazole;hydrochloride |
| PubChem CID | 44782304 |
| Molecular Formula | C19H17ClN4 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2,3,5-triphenyl-1H-tetrazole;hydrochloride |
| SMILES | Cl.c1ccc(C2=NN(c3ccccc3)N(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C19H16N4.ClH/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18;/h1-15H,(H,20,21);1H |
| InChIKey | LCJINPXTMHVZGV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3,5-triphenyl-1H-tetrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-triphenyl-1H-tetrazole;hydrochloride?
The IUPAC name of 2,3,5-triphenyl-1H-tetrazole;hydrochloride (CID 44782304) is 2,3,5-triphenyl-1H-tetrazole;hydrochloride.
What is the SMILES notation for 2,3,5-triphenyl-1H-tetrazole;hydrochloride?
The canonical SMILES for 2,3,5-triphenyl-1H-tetrazole;hydrochloride is Cl.c1ccc(C2=NN(c3ccccc3)N(c3ccccc3)N2)cc1.
What is the InChIKey of 2,3,5-triphenyl-1H-tetrazole;hydrochloride?
The InChIKey is LCJINPXTMHVZGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4.ClH/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18;/h1-15H,(H,20,21);1H.
What are the key properties of 2,3,5-triphenyl-1H-tetrazole;hydrochloride?
2,3,5-triphenyl-1H-tetrazole;hydrochloride has a molecular weight of 336.83 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-triphenyl-1H-tetrazole;hydrochloride is sourced from PubChem (CID 44782304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).