About 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide
1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide (PubChem CID 44782319) has the molecular formula C21H25BrN2O2S
and a molecular weight of 449.41 g/mol. Its IUPAC name is 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide.
Molecular Properties
| Compound Name | 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide |
| PubChem CID | 44782319 |
| Molecular Formula | C21H25BrN2O2S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide |
| SMILES | Br.COc1ccc2c(c1)nc(SCC(=O)C(C)(C)C)n2Cc1ccccc1 |
| InChI | InChI=1S/C21H24N2O2S.BrH/c1-21(2,3)19(24)14-26-20-22-17-12-16(25-4)10-11-18(17)23(20)13-15-8-6-5-7-9-15;/h5-12H,13-14H2,1-4H3;1H |
| InChIKey | APBKLVXMKATEIY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide?
The IUPAC name of 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide (CID 44782319) is 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide.
What is the SMILES notation for 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide?
The canonical SMILES for 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide is Br.COc1ccc2c(c1)nc(SCC(=O)C(C)(C)C)n2Cc1ccccc1.
What is the InChIKey of 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide?
The InChIKey is APBKLVXMKATEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O2S.BrH/c1-21(2,3)19(24)14-26-20-22-17-12-16(25-4)10-11-18(17)23(20)13-15-8-6-5-7-9-15;/h5-12H,13-14H2,1-4H3;1H.
What are the key properties of 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide?
1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide has a molecular weight of 449.41 g/mol, XLogP of 5.38, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-benzyl-5-methoxybenzimidazol-2-yl)sulfanyl-3,3-dimethylbutan-2-one;hydrobromide is sourced from PubChem (CID 44782319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).