C14H21N3S — CID 44782527
5-(3,5-dimethyl-1-adamantyl)-1,3,4-thiadiazol-2-amine (PubChem CID 44782527) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1-adamantyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3,5-dimethyl-1-adamantyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 44782527 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 5-(3,5-dimethyl-1-adamantyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC12CC3CC(C)(C1)CC(c1nnc(N)s1)(C3)C2 |
| InChI | InChI=1S/C14H21N3S/c1-12-3-9-4-13(2,6-12)8-14(5-9,7-12)10-16-17-11(15)18-10/h9H,3-8H2,1-2H3,(H2,15,17) |
| InChIKey | UHDCZTHQKYYBPZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |