C15H30ClNO2 — CID 44782571
1-cyclohexyloxy-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride (PubChem CID 44782571) has the molecular formula C15H30ClNO2 and a molecular weight of 291.86 g/mol. Its IUPAC name is 1-cyclohexyloxy-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride.
| Compound Name | 1-cyclohexyloxy-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 44782571 |
| Molecular Formula | C15H30ClNO2 |
| Molecular Weight | 291.86 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1-cyclohexyloxy-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride |
| SMILES | CC1CCN(CC(O)COC2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C15H29NO2.ClH/c1-13-7-9-16(10-8-13)11-14(17)12-18-15-5-3-2-4-6-15;/h13-15,17H,2-12H2,1H3;1H |
| InChIKey | IMQDZAYJBMEOEY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |