C15H32Cl2N2O2 — CID 44782589
1-cyclohexyloxy-3-(4-ethylpiperazin-1-yl)propan-2-ol;dihydrochloride (PubChem CID 44782589) has the molecular formula C15H32Cl2N2O2 and a molecular weight of 343.34 g/mol. Its IUPAC name is 1-cyclohexyloxy-3-(4-ethylpiperazin-1-yl)propan-2-ol;dihydrochloride.
| Compound Name | 1-cyclohexyloxy-3-(4-ethylpiperazin-1-yl)propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 44782589 |
| Molecular Formula | C15H32Cl2N2O2 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-cyclohexyloxy-3-(4-ethylpiperazin-1-yl)propan-2-ol;dihydrochloride |
| SMILES | CCN1CCN(CC(O)COC2CCCCC2)CC1.Cl.Cl |
| InChI | InChI=1S/C15H30N2O2.2ClH/c1-2-16-8-10-17(11-9-16)12-14(18)13-19-15-6-4-3-5-7-15;;/h14-15,18H,2-13H2,1H3;2*1H |
| InChIKey | JFEBLJIWEGIDBY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |