C25H24N4O4S — CID 44783482
[4-(benzenesulfonyl)-3-(1H-benzimidazol-2-yl)piperazin-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 44783482) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-3-(1H-benzimidazol-2-yl)piperazin-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-(benzenesulfonyl)-3-(1H-benzimidazol-2-yl)piperazin-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 44783482 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | [4-(benzenesulfonyl)-3-(1H-benzimidazol-2-yl)piperazin-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(S(=O)(=O)c3ccccc3)C(c3nc4ccccc4[nH]3)C2)cc1 |
| InChI | InChI=1S/C25H24N4O4S/c1-33-19-13-11-18(12-14-19)25(30)28-15-16-29(34(31,32)20-7-3-2-4-8-20)23(17-28)24-26-21-9-5-6-10-22(21)27-24/h2-14,23H,15-17H2,1H3,(H,26,27) |
| InChIKey | VVXLVWPFPBNJCD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |