C23H20N4O5 — CID 44784644
(Z)-2-cyano-N-(4-hydroxyphenyl)-3-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 44784644) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is (Z)-2-cyano-N-(4-hydroxyphenyl)-3-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(4-hydroxyphenyl)-3-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 44784644 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (Z)-2-cyano-N-(4-hydroxyphenyl)-3-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(/C#N)C(=O)Nc3ccc(O)cc3)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20N4O5/c1-14-10-16(11-17(13-24)23(29)25-18-4-6-19(28)7-5-18)15(2)26(14)21-9-8-20(32-3)12-22(21)27(30)31/h4-12,28H,1-3H3,(H,25,29)/b17-11- |
| InChIKey | BFWPDSLXRQYQEM-BOPFTXTBSA-N |
| XLogP | 4.26 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|