About ethene;methyl 2-amino-N-methylethanimidate;hydrochloride
ethene;methyl 2-amino-N-methylethanimidate;hydrochloride (PubChem CID 44784851) has the molecular formula C6H15ClN2O
and a molecular weight of 166.65 g/mol. Its IUPAC name is ethene;methyl 2-amino-N-methylethanimidate;hydrochloride.
Molecular Properties
| Compound Name | ethene;methyl 2-amino-N-methylethanimidate;hydrochloride |
| PubChem CID | 44784851 |
| Molecular Formula | C6H15ClN2O |
| Molecular Weight | 166.65 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | ethene;methyl 2-amino-N-methylethanimidate;hydrochloride |
| SMILES | C/N=C(\CN)OC.C=C.Cl |
| InChI | InChI=1S/C4H10N2O.C2H4.ClH/c1-6-4(3-5)7-2;1-2;/h3,5H2,1-2H3;1-2H2;1H/b6-4+;; |
| InChIKey | DJSLNKBDEGCWAU-SLNOCBGISA-N |
| XLogP | 0.84 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.65 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;methyl 2-amino-N-methylethanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;methyl 2-amino-N-methylethanimidate;hydrochloride?
The IUPAC name of ethene;methyl 2-amino-N-methylethanimidate;hydrochloride (CID 44784851) is ethene;methyl 2-amino-N-methylethanimidate;hydrochloride.
What is the SMILES notation for ethene;methyl 2-amino-N-methylethanimidate;hydrochloride?
The canonical SMILES for ethene;methyl 2-amino-N-methylethanimidate;hydrochloride is C/N=C(\CN)OC.C=C.Cl.
What is the InChIKey of ethene;methyl 2-amino-N-methylethanimidate;hydrochloride?
The InChIKey is DJSLNKBDEGCWAU-SLNOCBGISA-N. The full InChI is InChI=1S/C4H10N2O.C2H4.ClH/c1-6-4(3-5)7-2;1-2;/h3,5H2,1-2H3;1-2H2;1H/b6-4+;;.
What are the key properties of ethene;methyl 2-amino-N-methylethanimidate;hydrochloride?
ethene;methyl 2-amino-N-methylethanimidate;hydrochloride has a molecular weight of 166.65 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;methyl 2-amino-N-methylethanimidate;hydrochloride is sourced from PubChem (CID 44784851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).