C11H18BN3O2 — CID 44784903
4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (PubChem CID 44784903) has the molecular formula C11H18BN3O2 and a molecular weight of 235.10 g/mol. Its IUPAC name is 4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine.
| Compound Name | 4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 44784903 |
| Molecular Formula | C11H18BN3O2 |
| Molecular Weight | 235.10 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)nc(N)n1 |
| InChI | InChI=1S/C11H18BN3O2/c1-7-6-8(15-9(13)14-7)12-16-10(2,3)11(4,5)17-12/h6H,1-5H3,(H2,13,14,15) |
| InChIKey | WWNNIKQJPMBRJH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.10 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|