C18H11NO5S — CID 44788406
N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)benzenesulfonamide (PubChem CID 44788406) has the molecular formula C18H11NO5S and a molecular weight of 353.36 g/mol. Its IUPAC name is N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)benzenesulfonamide.
| Compound Name | N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 44788406 |
| Molecular Formula | C18H11NO5S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-7-yl)benzenesulfonamide |
| SMILES | O=C1OC(=O)c2cc(NS(=O)(=O)c3ccccc3)cc3cccc1c23 |
| InChI | InChI=1S/C18H11NO5S/c20-17-14-8-4-5-11-9-12(10-15(16(11)14)18(21)24-17)19-25(22,23)13-6-2-1-3-7-13/h1-10,19H |
| InChIKey | KUQWUQXGRSBRLU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|