C14H18ClN3O3 — CID 44789139
1-(4-nitrophenyl)-2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)ethanone;hydrochloride (PubChem CID 44789139) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)ethanone;hydrochloride.
| Compound Name | 1-(4-nitrophenyl)-2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 44789139 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-(4-nitrophenyl)-2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)ethanone;hydrochloride |
| SMILES | Cl.O=C(CNC1=NCCCCC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N3O3.ClH/c18-13(10-16-14-4-2-1-3-9-15-14)11-5-7-12(8-6-11)17(19)20;/h5-8H,1-4,9-10H2,(H,15,16);1H |
| InChIKey | BUOIWUTYLIMCSE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|