About propan-2-yl 2-piperidin-1-ylacetate
propan-2-yl 2-piperidin-1-ylacetate (PubChem CID 44791468) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is propan-2-yl 2-piperidin-1-ylacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-piperidin-1-ylacetate |
| PubChem CID | 44791468 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | propan-2-yl 2-piperidin-1-ylacetate |
| SMILES | CC(C)OC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C10H19NO2/c1-9(2)13-10(12)8-11-6-4-3-5-7-11/h9H,3-8H2,1-2H3 |
| InChIKey | FXSBEEBIOBNYLF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 2-piperidin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-piperidin-1-ylacetate?
The IUPAC name of propan-2-yl 2-piperidin-1-ylacetate (CID 44791468) is propan-2-yl 2-piperidin-1-ylacetate.
What is the SMILES notation for propan-2-yl 2-piperidin-1-ylacetate?
The canonical SMILES for propan-2-yl 2-piperidin-1-ylacetate is CC(C)OC(=O)CN1CCCCC1.
What is the InChIKey of propan-2-yl 2-piperidin-1-ylacetate?
The InChIKey is FXSBEEBIOBNYLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-9(2)13-10(12)8-11-6-4-3-5-7-11/h9H,3-8H2,1-2H3.
What are the key properties of propan-2-yl 2-piperidin-1-ylacetate?
propan-2-yl 2-piperidin-1-ylacetate has a molecular weight of 185.27 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-piperidin-1-ylacetate is sourced from PubChem (CID 44791468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).