C13H10ClFN2O3S2 — CID 44791596
(NE)-N-(4-chloro-5-formyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)-4-fluorobenzenesulfonamide (PubChem CID 44791596) has the molecular formula C13H10ClFN2O3S2 and a molecular weight of 360.82 g/mol. Its IUPAC name is (NE)-N-(4-chloro-5-formyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)-4-fluorobenzenesulfonamide.
| Compound Name | (NE)-N-(4-chloro-5-formyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 44791596 |
| Molecular Formula | C13H10ClFN2O3S2 |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | (NE)-N-(4-chloro-5-formyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)-4-fluorobenzenesulfonamide |
| SMILES | C=CCn1c(Cl)c(C=O)s/c1=N/S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H10ClFN2O3S2/c1-2-7-17-12(14)11(8-18)21-13(17)16-22(19,20)10-5-3-9(15)4-6-10/h2-6,8H,1,7H2/b16-13+ |
| InChIKey | NGLUBCPHELBAEP-DTQAZKPQSA-N |
| XLogP | 2.63 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|