C30H38FN7O — CID 44814465
N-(5-tert-butyl-2-methylphenyl)-2-[4-(3-fluoro-4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7-methylpurin-6-amine (PubChem CID 44814465) has the molecular formula C30H38FN7O and a molecular weight of 531.68 g/mol. Its IUPAC name is N-(5-tert-butyl-2-methylphenyl)-2-[4-(3-fluoro-4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7-methylpurin-6-amine.
| Compound Name | N-(5-tert-butyl-2-methylphenyl)-2-[4-(3-fluoro-4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7-methylpurin-6-amine |
|---|---|
| PubChem CID | 44814465 |
| Molecular Formula | C30H38FN7O |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | N-(5-tert-butyl-2-methylphenyl)-2-[4-(3-fluoro-4-methoxyphenyl)-3,3-dimethylpiperazin-1-yl]-7-methylpurin-6-amine |
| SMILES | COc1ccc(N2CCN(c3nc(Nc4cc(C(C)(C)C)ccc4C)c4c(ncn4C)n3)CC2(C)C)cc1F |
| InChI | InChI=1S/C30H38FN7O/c1-19-9-10-20(29(2,3)4)15-23(19)33-27-25-26(32-18-36(25)7)34-28(35-27)37-13-14-38(30(5,6)17-37)21-11-12-24(39-8)22(31)16-21/h9-12,15-16,18H,13-14,17H2,1-8H3,(H,33,34,35) |
| InChIKey | FZOKSKODODBZQQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|