About 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid
4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 44814948) has the molecular formula C11H12N2O6
and a molecular weight of 268.23 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 44814948 |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | N[C@@H](CO)C(=O)OCn1c(C(=O)O)cc2occc21 |
| InChI | InChI=1S/C11H12N2O6/c12-6(4-14)11(17)19-5-13-7-1-2-18-9(7)3-8(13)10(15)16/h1-3,6,14H,4-5,12H2,(H,15,16)/t6-/m0/s1 |
| InChIKey | OIGYCIVTBDWVQB-LURJTMIESA-N |
| XLogP | -0.25 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid (CID 44814948) is 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid is N[C@@H](CO)C(=O)OCn1c(C(=O)O)cc2occc21.
What is the InChIKey of 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is OIGYCIVTBDWVQB-LURJTMIESA-N. The full InChI is InChI=1S/C11H12N2O6/c12-6(4-14)11(17)19-5-13-7-1-2-18-9(7)3-8(13)10(15)16/h1-3,6,14H,4-5,12H2,(H,15,16)/t6-/m0/s1.
What are the key properties of 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid?
4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 268.23 g/mol, XLogP of -0.25, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 44814948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).