About 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide
5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide (PubChem CID 44814960) has the molecular formula C18H12ClFN4OS
and a molecular weight of 386.84 g/mol. Its IUPAC name is 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide |
| PubChem CID | 44814960 |
| Molecular Formula | C18H12ClFN4OS |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide |
| SMILES | CN(C(=O)c1nc(-c2cnn3ccccc23)c(Cl)s1)c1ccccc1F |
| InChI | InChI=1S/C18H12ClFN4OS/c1-23(14-8-3-2-6-12(14)20)18(25)17-22-15(16(19)26-17)11-10-21-24-9-5-4-7-13(11)24/h2-10H,1H3 |
| InChIKey | GSMDRNAQUQBQNK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide (CID 44814960) is 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide is CN(C(=O)c1nc(-c2cnn3ccccc23)c(Cl)s1)c1ccccc1F.
What is the InChIKey of 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide?
The InChIKey is GSMDRNAQUQBQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClFN4OS/c1-23(14-8-3-2-6-12(14)20)18(25)17-22-15(16(19)26-17)11-10-21-24-9-5-4-7-13(11)24/h2-10H,1H3.
What are the key properties of 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide?
5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide has a molecular weight of 386.84 g/mol, XLogP of 4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(2-fluorophenyl)-N-methyl-4-pyrazolo[1,5-a]pyridin-3-yl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 44814960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).