C28H34ClN3O3 — CID 44815018
[5-[[(3R)-3-(3-methylbut-2-enoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol chloride (PubChem CID 44815018) has the molecular formula C28H34ClN3O3 and a molecular weight of 496.05 g/mol. Its IUPAC name is [5-[[(3R)-3-(3-methylbut-2-enoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol chloride.
| Compound Name | [5-[[(3R)-3-(3-methylbut-2-enoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol chloride |
|---|---|
| PubChem CID | 44815018 |
| Molecular Formula | C28H34ClN3O3 |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | [5-[[(3R)-3-(3-methylbut-2-enoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol chloride |
| SMILES | CC(C)=CCO[C@H]1C[N+]2(Cc3nc(C(O)(c4ccccc4)c4ccccc4)no3)CCC1CC2.[Cl-] |
| InChI | InChI=1S/C28H34N3O3.ClH/c1-21(2)15-18-33-25-19-31(16-13-22(25)14-17-31)20-26-29-27(30-34-26)28(32,23-9-5-3-6-10-23)24-11-7-4-8-12-24;/h3-12,15,22,25,32H,13-14,16-20H2,1-2H3;1H/q+1;/p-1/t22?,25-,31?;/m0./s1 |
| InChIKey | MOSWQFBGXFFMRY-BRKBLGTFSA-M |
| XLogP | 1.45 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|