C34H42N4O5S — CID 44815551
N-[5-[(1R)-2-[2-[5-[[2-[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]ethylamino]methyl]thiophen-2-yl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide (PubChem CID 44815551) has the molecular formula C34H42N4O5S and a molecular weight of 618.80 g/mol. Its IUPAC name is N-[5-[(1R)-2-[2-[5-[[2-[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]ethylamino]methyl]thiophen-2-yl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide.
| Compound Name | N-[5-[(1R)-2-[2-[5-[[2-[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]ethylamino]methyl]thiophen-2-yl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
|---|---|
| PubChem CID | 44815551 |
| Molecular Formula | C34H42N4O5S |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | N-[5-[(1R)-2-[2-[5-[[2-[2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]ethylamino]methyl]thiophen-2-yl]ethylamino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
| SMILES | O=CNc1cc([C@@H](O)CNCCc2ccc(CNCCc3cnc([C@](O)(c4ccccc4)C4CCCCC4)o3)s2)ccc1O |
| InChI | InChI=1S/C34H42N4O5S/c39-23-38-30-19-24(11-14-31(30)40)32(41)22-36-18-16-28-12-13-29(44-28)21-35-17-15-27-20-37-33(43-27)34(42,25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1,3-4,7-8,11-14,19-20,23,26,32,35-36,40-42H,2,5-6,9-10,15-18,21-22H2,(H,38,39)/t32-,34-/m0/s1 |
| InChIKey | VJVGXPMTRPQAGJ-TWJUONSBSA-N |
| XLogP | 5.02 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|