C32H37N7O13 — CID 44815733
[5-[[(2S)-2,3-dinitrooxypropoxy]methyl]-2-oxo-1,3-dioxol-4-yl]methyl (2S)-3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate (PubChem CID 44815733) has the molecular formula C32H37N7O13 and a molecular weight of 727.68 g/mol. Its IUPAC name is [5-[[(2S)-2,3-dinitrooxypropoxy]methyl]-2-oxo-1,3-dioxol-4-yl]methyl (2S)-3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate.
| Compound Name | [5-[[(2S)-2,3-dinitrooxypropoxy]methyl]-2-oxo-1,3-dioxol-4-yl]methyl (2S)-3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate |
|---|---|
| PubChem CID | 44815733 |
| Molecular Formula | C32H37N7O13 |
| Molecular Weight | 727.68 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | [5-[[(2S)-2,3-dinitrooxypropoxy]methyl]-2-oxo-1,3-dioxol-4-yl]methyl (2S)-3-methyl-2-[pentanoyl-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]amino]butanoate |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1)[C@H](C(=O)OCc1oc(=O)oc1COC[C@@H](CO[N+](=O)[O-])O[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C32H37N7O13/c1-4-5-10-28(40)37(15-21-11-13-22(14-12-21)24-8-6-7-9-25(24)30-33-35-36-34-30)29(20(2)3)31(41)48-19-27-26(50-32(42)51-27)18-47-16-23(52-39(45)46)17-49-38(43)44/h6-9,11-14,20,23,29H,4-5,10,15-19H2,1-3H3,(H,33,34,35,36)/t23-,29-/m0/s1 |
| InChIKey | MRWSYCAZHMNFOD-IADCTJSHSA-N |
| XLogP | 3.67 |
| TPSA | 258.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|