C34H36N4O5S — CID 44815889
N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[2-[5-[[2-[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]ethylamino]methyl]thiophen-2-yl]ethylamino]ethyl]phenyl]formamide (PubChem CID 44815889) has the molecular formula C34H36N4O5S and a molecular weight of 612.75 g/mol. Its IUPAC name is N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[2-[5-[[2-[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]ethylamino]methyl]thiophen-2-yl]ethylamino]ethyl]phenyl]formamide.
| Compound Name | N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[2-[5-[[2-[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]ethylamino]methyl]thiophen-2-yl]ethylamino]ethyl]phenyl]formamide |
|---|---|
| PubChem CID | 44815889 |
| Molecular Formula | C34H36N4O5S |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | N-[2-hydroxy-5-[(1R)-1-hydroxy-2-[2-[5-[[2-[2-[hydroxy(diphenyl)methyl]-1,3-oxazol-5-yl]ethylamino]methyl]thiophen-2-yl]ethylamino]ethyl]phenyl]formamide |
| SMILES | O=CNc1cc([C@@H](O)CNCCc2ccc(CNCCc3cnc(C(O)(c4ccccc4)c4ccccc4)o3)s2)ccc1O |
| InChI | InChI=1S/C34H36N4O5S/c39-23-38-30-19-24(11-14-31(30)40)32(41)22-36-18-16-28-12-13-29(44-28)21-35-17-15-27-20-37-33(43-27)34(42,25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-14,19-20,23,32,35-36,40-42H,15-18,21-22H2,(H,38,39)/t32-/m0/s1 |
| InChIKey | ZIHMMRYDDZIDTQ-YTTGMZPUSA-N |
| XLogP | 4.49 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|