C30H32ClN3O2S — CID 44816017
[5-[[(3R)-3-benzylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol chloride (PubChem CID 44816017) has the molecular formula C30H32ClN3O2S and a molecular weight of 534.13 g/mol. Its IUPAC name is [5-[[(3R)-3-benzylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol chloride.
| Compound Name | [5-[[(3R)-3-benzylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol chloride |
|---|---|
| PubChem CID | 44816017 |
| Molecular Formula | C30H32ClN3O2S |
| Molecular Weight | 534.13 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | [5-[[(3R)-3-benzylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol chloride |
| SMILES | OC(c1ccccc1)(c1ccccc1)c1noc(C[N+]23CCC(CC2)[C@@H](SCc2ccccc2)C3)n1.[Cl-] |
| InChI | InChI=1S/C30H32N3O2S.ClH/c34-30(25-12-6-2-7-13-25,26-14-8-3-9-15-26)29-31-28(35-32-29)21-33-18-16-24(17-19-33)27(20-33)36-22-23-10-4-1-5-11-23;/h1-15,24,27,34H,16-22H2;1H/q+1;/p-1/t24?,27-,33?;/m0./s1 |
| InChIKey | RMUSHQWMOIUZRN-UPDBXMIASA-M |
| XLogP | 2.40 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|