C30H30F2N3O4S+ — CID 44816390
[5-[[(3R)-3-(3,4-difluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol;formic acid (PubChem CID 44816390) has the molecular formula C30H30F2N3O4S+ and a molecular weight of 566.65 g/mol. Its IUPAC name is [5-[[(3R)-3-(3,4-difluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol;formic acid.
| Compound Name | [5-[[(3R)-3-(3,4-difluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol;formic acid |
|---|---|
| PubChem CID | 44816390 |
| Molecular Formula | C30H30F2N3O4S+ |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [5-[[(3R)-3-(3,4-difluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]-diphenylmethanol;formic acid |
| SMILES | O=CO.OC(c1ccccc1)(c1ccccc1)c1noc(C[N+]23CCC(CC2)[C@@H](Sc2ccc(F)c(F)c2)C3)n1 |
| InChI | InChI=1S/C29H28F2N3O2S.CH2O2/c30-24-12-11-23(17-25(24)31)37-26-18-34(15-13-20(26)14-16-34)19-27-32-28(33-36-27)29(35,21-7-3-1-4-8-21)22-9-5-2-6-10-22;2-1-3/h1-12,17,20,26,35H,13-16,18-19H2;1H,(H,2,3)/q+1;/t20?,26-,34?;/m0./s1 |
| InChIKey | PFHUPNIORCAIIV-VEDZBQDOSA-N |
| XLogP | 5.23 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|