C23H21FN2O5S — CID 44816533
2-[[5-[[4-(2-fluoro-3-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 44816533) has the molecular formula C23H21FN2O5S and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[[5-[[4-(2-fluoro-3-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[5-[[4-(2-fluoro-3-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 44816533 |
| Molecular Formula | C23H21FN2O5S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[[5-[[4-(2-fluoro-3-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCCC2NS(=O)(=O)c1ccc(-c2cccnc2F)cc1 |
| InChI | InChI=1S/C23H21FN2O5S/c24-23-17(6-3-13-25-23)15-9-11-16(12-10-15)32(29,30)26-20-7-1-5-19-18(20)4-2-8-21(19)31-14-22(27)28/h2-4,6,8-13,20,26H,1,5,7,14H2,(H,27,28) |
| InChIKey | GRKJREIEHWZOEL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|