C27H32FN7O2S — CID 44816691
8-[1-[1-[(3-aminophenyl)methyl]-4-fluoropiperidine-4-carbonyl]piperidin-4-yl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraen-7-one (PubChem CID 44816691) has the molecular formula C27H32FN7O2S and a molecular weight of 537.67 g/mol. Its IUPAC name is 8-[1-[1-[(3-aminophenyl)methyl]-4-fluoropiperidine-4-carbonyl]piperidin-4-yl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraen-7-one.
| Compound Name | 8-[1-[1-[(3-aminophenyl)methyl]-4-fluoropiperidine-4-carbonyl]piperidin-4-yl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraen-7-one |
|---|---|
| PubChem CID | 44816691 |
| Molecular Formula | C27H32FN7O2S |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 8-[1-[1-[(3-aminophenyl)methyl]-4-fluoropiperidine-4-carbonyl]piperidin-4-yl]-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraen-7-one |
| SMILES | Cc1nnc2n1-c1sccc1C(=O)N(C1CCN(C(=O)C3(F)CCN(Cc4cccc(N)c4)CC3)CC1)C2 |
| InChI | InChI=1S/C27H32FN7O2S/c1-18-30-31-23-17-34(24(36)22-7-14-38-25(22)35(18)23)21-5-10-33(11-6-21)26(37)27(28)8-12-32(13-9-27)16-19-3-2-4-20(29)15-19/h2-4,7,14-15,21H,5-6,8-13,16-17,29H2,1H3 |
| InChIKey | WCAZLMSWHVXVJZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|