C24H23FN2O5S — CID 44816707
2-[[5-[[4-(6-fluoro-5-methyl-3-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 44816707) has the molecular formula C24H23FN2O5S and a molecular weight of 470.52 g/mol. Its IUPAC name is 2-[[5-[[4-(6-fluoro-5-methyl-3-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[5-[[4-(6-fluoro-5-methyl-3-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 44816707 |
| Molecular Formula | C24H23FN2O5S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-[[5-[[4-(6-fluoro-5-methyl-3-pyridinyl)phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)NC3CCCc4c(OCC(=O)O)cccc43)cc2)cnc1F |
| InChI | InChI=1S/C24H23FN2O5S/c1-15-12-17(13-26-24(15)25)16-8-10-18(11-9-16)33(30,31)27-21-6-2-5-20-19(21)4-3-7-22(20)32-14-23(28)29/h3-4,7-13,21,27H,2,5-6,14H2,1H3,(H,28,29) |
| InChIKey | QGBBICQXEKECOW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|